EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12N4O2 |
| Net Charge | +2 |
| Average Mass | 268.276 |
| Monoisotopic Mass | 268.09493 |
| SMILES | COc1cc(-c2ccc([N+]#N)c(OC)c2)ccc1[N+]#N |
| InChI | InChI=1S/C14H12N4O2/c1-19-13-7-9(3-5-11(13)17-15)10-4-6-12(18-16)14(8-10)20-2/h3-8H,1-2H3/q+2 |
| InChIKey | QMMMCTXNYMSXLI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fast blue B (CHEBI:87629) has role histological dye (CHEBI:77178) |
| fast blue B (CHEBI:87629) is a aromatic diazonium ion (CHEBI:53507) |
| Incoming Relation(s) |
| fast blue salt B (CHEBI:87627) has part fast blue B (CHEBI:87629) |
| IUPAC Name |
|---|
| 3,3'-dimethoxy[1,1'-biphenyl]-4,4'-bis(diazonium) |
| Synonyms | Source |
|---|---|
| C.I. 37235 | ChemIDplus |
| C.I.Azoic Diazo Component 48 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1499067 | Reaxys |
| CAS:20282-70-6 | ChemIDplus |
| Citations |
|---|