EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12N4O2.4Cl.Zn |
| Net Charge | 0 |
| Average Mass | 475.478 |
| Monoisotopic Mass | 471.90058 |
| SMILES | COc1cc(-c2ccc([N+]#N)c(OC)c2)ccc1[N+]#N.[Cl-].[Cl-].[Cl-].[Cl-].[Zn+2] |
| InChI | InChI=1S/C14H12N4O2.4ClH.Zn/c1-19-13-7-9(3-5-11(13)17-15)10-4-6-12(18-16)14(8-10)20-2;;;;;/h3-8H,1-2H3;4*1H;/q+2;;;;;+2/p-4 |
| InChIKey | GPPKNJIWDULNQH-UHFFFAOYSA-J |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fast blue salt B (CHEBI:87627) has part fast blue B (CHEBI:87629) |
| fast blue salt B (CHEBI:87627) has part zinc dichloride (CHEBI:49976) |
| fast blue salt B (CHEBI:87627) has role histological dye (CHEBI:77178) |
| fast blue salt B (CHEBI:87627) is a organic chloride salt (CHEBI:36094) |
| fast blue salt B (CHEBI:87627) is a zinc molecular entity (CHEBI:27364) |
| IUPAC Names |
|---|
| 3,3'-dimethoxy[1,1'-biphenyl]-4,4'-bis(diazonium) chloride—dichlorozinc (1/2/1) |
| 3,3'-dimethoxy[1,1'-biphenyl]-4,4'-bis(diazonium) zinc chloride (1/1/4) |
| Synonyms | Source |
|---|---|
| (3,3-dimethoxy(1,1-biphenyl)-4,4'-diyl)bisbenzenediazonium dichloride zinc chloride | ChemIDplus |
| 3,3'-Dimethoxybiphenyl-4,4'-di(diazonium) zinc chloride | ChemIDplus |
| Azoic diazo 48 | ChEBI |
| C.I. 37235 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:14263-94-6 | ChemIDplus |
| Citations |
|---|