EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C28H27N3O3 |
| Net Charge | +1 |
| Average Mass | 454.550 |
| Monoisotopic Mass | 454.21252 |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)/C=C/c1c(-c3ccccc3)n(C)c3ncccc13)CC2.[H+] |
| InChI | InChI=1S/C28H27N3O3/c1-30-27(19-8-5-4-6-9-19)22(23-10-7-14-29-28(23)30)11-12-26(32)31-15-13-20-16-24(33-2)25(34-3)17-21(20)18-31/h4-12,14,16-17H,13,15,18H2,1-3H3/p+1/b12-11+ |
| InChIKey | IJYPHMXWKKKHGT-VAWYXSNFSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SIS3 free base(1+) (CHEBI:87591) is a ammonium ion derivative (CHEBI:35274) |
| SIS3 free base(1+) (CHEBI:87591) is conjugate acid of SIS3 free base (CHEBI:87589) |
| Incoming Relation(s) |
| SIS3 (CHEBI:87461) has part SIS3 free base(1+) (CHEBI:87591) |
| SIS3 free base (CHEBI:87589) is conjugate base of SIS3 free base(1+) (CHEBI:87591) |