EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H27N3O3.HCl |
| Net Charge | 0 |
| Average Mass | 490.003 |
| Monoisotopic Mass | 489.18192 |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)/C=C/c1c(-c3ccccc3)n(C)c3ncccc13)CC2.Cl |
| InChI | InChI=1S/C28H27N3O3.ClH/c1-30-27(19-8-5-4-6-9-19)22(23-10-7-14-29-28(23)30)11-12-26(32)31-15-13-20-16-24(33-2)25(34-3)17-21(20)18-31;/h4-12,14,16-17H,13,15,18H2,1-3H3;1H/b12-11+; |
| InChIKey | CDKIEBFIMCSCBB-CALJPSDSSA-N |
| Roles Classification |
|---|
| Biological Role: | Smad3 inhibitor An inhibitor of the SMAD3 protein. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SIS3 (CHEBI:87461) has part SIS3 free base(1+) (CHEBI:87591) |
| SIS3 (CHEBI:87461) has role Smad3 inhibitor (CHEBI:87588) |
| SIS3 (CHEBI:87461) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| (2E)-1-(6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)-3-(1-methyl-2-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-en-1-one hydrochloride |
| Synonyms | Source |
|---|---|
| (E)-1-(6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)-3-(1-methyl-2-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-en-1-one HCl | ChEBI |
| specific inhibitor of SMAD3 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10318892 | Reaxys |
| Citations |
|---|