EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H25N4 |
| Net Charge | +1 |
| Average Mass | 405.525 |
| Monoisotopic Mass | 405.20737 |
| SMILES | Cc1ccc(Nc2ccc3nc4cc(C)c(N)cc4[n+](-c4ccc(C)cc4)c3c2)cc1 |
| InChI | InChI=1S/C27H24N4/c1-17-4-8-20(9-5-17)29-21-10-13-24-26(15-21)31(22-11-6-18(2)7-12-22)27-16-23(28)19(3)14-25(27)30-24/h4-16H,1-3H3,(H2,28,29)/p+1 |
| InChIKey | DKQUIODWVIDJTF-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mauveine B2 (CHEBI:87482) has role histological dye (CHEBI:77178) |
| mauveine B2 (CHEBI:87482) is a organic cation (CHEBI:25697) |
| mauveine B2 (CHEBI:87482) is a phenazines (CHEBI:39201) |
| Incoming Relation(s) |
| mauveine (CHEBI:87479) has part mauveine B2 (CHEBI:87482) |
| Synonym | Source |
|---|---|
| 3-amino-2-methyl-7-(4-methylanilino)-5-(4-methylphenyl)phenazin-5-ium | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11140322 | Reaxys |
| Citations |
|---|