EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H27N3O9S3 |
| Net Charge | -2 |
| Average Mass | 753.836 |
| Monoisotopic Mass | 753.09204 |
| SMILES | O=S(=O)([O-])c1ccc(Nc2ccc(C(=C3C=CC(=[NH+]c4ccc(S(=O)(=O)[O-])cc4)C=C3)c3ccc(Nc4ccc(S(=O)(=O)[O-])cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H29N3O9S3/c41-50(42,43)34-19-13-31(14-20-34)38-28-7-1-25(2-8-28)37(26-3-9-29(10-4-26)39-32-15-21-35(22-16-32)51(44,45)46)27-5-11-30(12-6-27)40-33-17-23-36(24-18-33)52(47,48)49/h1-24,38-39H,(H,41,42,43)(H,44,45,46)(H,47,48,49)/p-2 |
| InChIKey | RFKJHQXSLBUONF-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl blue(2−) (CHEBI:87478) is a organosulfonate oxoanion (CHEBI:33554) |
| methyl blue(2−) (CHEBI:87478) is conjugate base of methyl blue free acid (CHEBI:87477) |
| Incoming Relation(s) |
| methyl blue (CHEBI:87472) has part methyl blue(2−) (CHEBI:87478) |
| methyl blue free acid (CHEBI:87477) is conjugate acid of methyl blue(2−) (CHEBI:87478) |
| IUPAC Name |
|---|
| 4,4'-{({4-[(4-sulfonatophenyl)iminio]cyclohexa-2,5-dien-1-ylidene}methylene)bis[(4,1-phenylene)azanediyl]}di(benzene-1-sulfonate) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13789956 | Reaxys |