EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H29N3O9S3 |
| Net Charge | 0 |
| Average Mass | 755.852 |
| Monoisotopic Mass | 755.10659 |
| SMILES | O=S(=O)(O)c1ccc(N=C2C=CC(=C(c3ccc(Nc4ccc(S(=O)(=O)O)cc4)cc3)c3ccc(Nc4ccc(S(=O)(=O)O)cc4)cc3)C=C2)cc1 |
| InChI | InChI=1S/C37H29N3O9S3/c41-50(42,43)34-19-13-31(14-20-34)38-28-7-1-25(2-8-28)37(26-3-9-29(10-4-26)39-32-15-21-35(22-16-32)51(44,45)46)27-5-11-30(12-6-27)40-33-17-23-36(24-18-33)52(47,48)49/h1-24,38-39H,(H,41,42,43)(H,44,45,46)(H,47,48,49) |
| InChIKey | RFKJHQXSLBUONF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl blue free acid (CHEBI:87477) is a arenesulfonic acid (CHEBI:33555) |
| methyl blue free acid (CHEBI:87477) is a aromatic amine (CHEBI:33860) |
| methyl blue free acid (CHEBI:87477) is a imine (CHEBI:24783) |
| methyl blue free acid (CHEBI:87477) is a secondary amino compound (CHEBI:50995) |
| methyl blue free acid (CHEBI:87477) is conjugate acid of methyl blue(2−) (CHEBI:87478) |
| Incoming Relation(s) |
| methyl blue(2−) (CHEBI:87478) is conjugate base of methyl blue free acid (CHEBI:87477) |
| IUPAC Name |
|---|
| 4,4'-{({4-[(4-sulfophenyl)imino]cyclohexa-2,5-dien-1-ylidene}methylene)bis[(4,1-phenylene)azanediyl]}di(benzene-1-sulfonic acid) |
| Synonym | Source |
|---|---|
| Aniline blue | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27536483 | Reaxys |
| CAS:61489-48-3 | ChemIDplus |