EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87425 - juvenile hormone I acid
| Formula | C17H28O3 |
| Net Charge | 0 |
| Average Mass | 280.408 |
| Monoisotopic Mass | 280.20384 |
| SMILES | CC/C(=C\CC/C(C)=C/C(=O)O)CC[C@H]1O[C@@]1(C)CC |
| InChI | InChI=1S/C17H28O3/c1-5-14(9-7-8-13(3)12-16(18)19)10-11-15-17(4,6-2)20-15/h9,12,15H,5-8,10-11H2,1-4H3,(H,18,19)/b13-12+,14-9+/t15-,17+/m1/s1 |
| InChIKey | NOBXVLJGTXXXFP-JFYQMXRCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| juvenile hormone I acid (CHEBI:87425) is a branched-chain fatty acid (CHEBI:35819) |
| juvenile hormone I acid (CHEBI:87425) is a epoxy fatty acid (CHEBI:61498) |
| juvenile hormone I acid (CHEBI:87425) is a juvenile hormone (CHEBI:24943) |
| juvenile hormone I acid (CHEBI:87425) is a olefinic fatty acid (CHEBI:53339) |
| juvenile hormone I acid (CHEBI:87425) is a polyunsaturated fatty acid (CHEBI:26208) |
| juvenile hormone I acid (CHEBI:87425) is conjugate acid of juvenile hormone I carboxylate (CHEBI:87109) |
| Incoming Relation(s) |
| juvenile hormone I carboxylate (CHEBI:87109) is conjugate base of juvenile hormone I acid (CHEBI:87425) |
| IUPAC Name |
|---|
| (2E,6E)-7-ethyl-9-[(2R,3S)-3-ethyl-3-methyloxiran-2-yl]-3-methylnona-2,6-dienoic acid |
| Synonym | Source |
|---|---|
| juvenile hormone I carboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-17900 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:50518-15-5 | ChemIDplus |