EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H27O3 |
| Net Charge | -1 |
| Average Mass | 279.400 |
| Monoisotopic Mass | 279.19657 |
| SMILES | CC/C(=C\CC/C(C)=C/C(=O)[O-])CC[C@H]1O[C@@]1(C)CC |
| InChI | InChI=1S/C17H28O3/c1-5-14(9-7-8-13(3)12-16(18)19)10-11-15-17(4,6-2)20-15/h9,12,15H,5-8,10-11H2,1-4H3,(H,18,19)/p-1/b13-12+,14-9+/t15-,17+/m1/s1 |
| InChIKey | NOBXVLJGTXXXFP-JFYQMXRCSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| juvenile hormone I carboxylate (CHEBI:87109) is a branched-chain fatty acid anion (CHEBI:58955) |
| juvenile hormone I carboxylate (CHEBI:87109) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| juvenile hormone I carboxylate (CHEBI:87109) is conjugate base of juvenile hormone I acid (CHEBI:87425) |
| Incoming Relation(s) |
| juvenile hormone I acid (CHEBI:87425) is conjugate acid of juvenile hormone I carboxylate (CHEBI:87109) |
| IUPAC Name |
|---|
| (2E,6E)-7-ethyl-9-[(2R,3S)-3-ethyl-3-methyloxiran-2-yl]-3-methylnona-2,6-dienoate |
| Synonym | Source |
|---|---|
| juvenile hormone I acid anion | ChEBI |
| UniProt Name | Source |
|---|---|
| juvenile hormone I carboxylate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-17900 | MetaCyc |