EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O2 |
| Net Charge | 0 |
| Average Mass | 172.268 |
| Monoisotopic Mass | 172.14633 |
| SMILES | CCCCCC(=O)OCC(C)C |
| InChI | InChI=1S/C10H20O2/c1-4-5-6-7-10(11)12-8-9(2)3/h9H,4-8H2,1-3H3 |
| InChIKey | UXUPPWPIGVTVQI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isobutyl hexanoate (CHEBI:87421) has functional parent isobutanol (CHEBI:46645) |
| isobutyl hexanoate (CHEBI:87421) has role metabolite (CHEBI:25212) |
| isobutyl hexanoate (CHEBI:87421) is a hexanoate ester (CHEBI:87656) |
| IUPAC Name |
|---|
| 2-methylpropyl hexanoate |
| Synonyms | Source |
|---|---|
| hexanoic acid 2-methylpropyl ester | ChEBI |
| isobutyl caproate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0036228 | HMDB |
| Citations |
|---|