EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H46N8S4 |
| Net Charge | +2 |
| Average Mass | 767.132 |
| Monoisotopic Mass | 766.27173 |
| SMILES | Cc1cc2sc(-c3ccc(/N=N/c4ccc(-c5nc6cc(CSC(N(C)C)=[N+](C)C)c(C)cc6s5)cc4)cc3)nc2cc1CSC(N(C)C)=[N+](C)C |
| InChI | InChI=1S/C40H46N8S4/c1-25-19-35-33(21-29(25)23-49-39(45(3)4)46(5)6)41-37(51-35)27-11-15-31(16-12-27)43-44-32-17-13-28(14-18-32)38-42-34-22-30(26(2)20-36(34)52-38)24-50-40(47(7)8)48(9)10/h11-22H,23-24H2,1-10H3/q+2/b44-43+ |
| InChIKey | QMKQNEXRGZFFKQ-VGFSZAGXSA-N |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alcian yellow cation (CHEBI:87353) has role fluorochrome (CHEBI:51217) |
| alcian yellow cation (CHEBI:87353) has role histological dye (CHEBI:77178) |
| alcian yellow cation (CHEBI:87353) is a benzothiazoles (CHEBI:37947) |
| alcian yellow cation (CHEBI:87353) is a iminium ion (CHEBI:35286) |
| Incoming Relation(s) |
| alcian yellow (CHEBI:87352) has part alcian yellow cation (CHEBI:87353) |
| IUPAC Name |
|---|
| {diazenediylbis[(4,1-phenylene)(6-methyl-1,3-benzothiazole-2,5-diyl)methylenesulfanediyl]}bis[(dimethylamino)-N,N-dimethylmethaniminium] |
| Synonym | Source |
|---|---|
| alcian yellow(1+) | ChEBI |