EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H46N8S4.2Cl |
| Net Charge | 0 |
| Average Mass | 838.038 |
| Monoisotopic Mass | 836.21053 |
| SMILES | Cc1cc2sc(-c3ccc(N=Nc4ccc(-c5nc6cc(CSC(N(C)C)=[N+](C)C)c(C)cc6s5)cc4)cc3)nc2cc1CSC(N(C)C)=[N+](C)C.[Cl-].[Cl-] |
| InChI | InChI=1S/C40H46N8S4.2ClH/c1-25-19-35-33(21-29(25)23-49-39(45(3)4)46(5)6)41-37(51-35)27-11-15-31(16-12-27)43-44-32-17-13-28(14-18-32)38-42-34-22-30(26(2)20-36(34)52-38)24-50-40(47(7)8)48(9)10;;/h11-22H,23-24H2,1-10H3;2*1H/q+2;;/p-2 |
| InChIKey | PBTFWNIEMRWXLI-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alcian yellow (CHEBI:87352) has part alcian yellow cation (CHEBI:87353) |
| alcian yellow (CHEBI:87352) has role fluorochrome (CHEBI:51217) |
| alcian yellow (CHEBI:87352) has role histological dye (CHEBI:77178) |
| alcian yellow (CHEBI:87352) is a iminium salt (CHEBI:35277) |
| alcian yellow (CHEBI:87352) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| {diazenediylbis[(4,1-phenylene)(6-methyl-1,3-benzothiazole-2,5-diyl)methylenesulfanediyl]}bis[(dimethylamino)-N,N-dimethylmethaniminium] dichloride |
| Synonyms | Source |
|---|---|
| C.I. 12840 | ChEBI |
| C.I. Ingrain Yellow 1 | ChemIDplus |
| ingrain yellow | ChEBI |
| ingrain yellow 1 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Alcian_yellow | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:61968-76-1 | ChemIDplus |
| Citations |
|---|