EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO4S |
| Net Charge | 0 |
| Average Mass | 239.252 |
| Monoisotopic Mass | 239.02523 |
| SMILES | Nc1ccc2c(O)cc(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C10H9NO4S/c11-7-1-2-9-6(3-7)4-8(5-10(9)12)16(13,14)15/h1-5,12H,11H2,(H,13,14,15) |
| InChIKey | KYARBIJYVGJZLB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-amino-4-hydroxy-2-naphthalenesulfonic acid (CHEBI:87316) has role metabolite (CHEBI:25212) |
| 7-amino-4-hydroxy-2-naphthalenesulfonic acid (CHEBI:87316) is a aminonaphthalenesulfonic acid (CHEBI:38210) |
| 7-amino-4-hydroxy-2-naphthalenesulfonic acid (CHEBI:87316) is a naphthols (CHEBI:25392) |
| IUPAC Name |
|---|
| 7-amino-4-hydroxynaphthalene-2-sulfonic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2217192 | Reaxys |
| CAS:87-02-5 | ChemIDplus |