EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O3 |
| Net Charge | 0 |
| Average Mass | 130.143 |
| Monoisotopic Mass | 130.06299 |
| SMILES | [H]C(=O)CCC(=O)OCC |
| InChI | InChI=1S/C6H10O3/c1-2-9-6(8)4-3-5-7/h5H,2-4H2,1H3 |
| InChIKey | QFMPHCGACBODIJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 4-oxobutanoate (CHEBI:87282) has functional parent ethanol (CHEBI:16236) |
| ethyl 4-oxobutanoate (CHEBI:87282) has functional parent succinic semialdehyde (CHEBI:16265) |
| ethyl 4-oxobutanoate (CHEBI:87282) has role metabolite (CHEBI:25212) |
| ethyl 4-oxobutanoate (CHEBI:87282) is a aldehyde (CHEBI:17478) |
| ethyl 4-oxobutanoate (CHEBI:87282) is a carboxylic ester (CHEBI:33308) |
| IUPAC Name |
|---|
| ethyl 4-oxobutanoate |
| Synonyms | Source |
|---|---|
| 3-ethoxycarbonylpropionaldehyde | ChEBI |
| 4-oxo-butanoic acid ethyl ester | ChEBI |
| 4-oxo-butyric acid ethyl ester | ChEBI |
| ethyl 3-formylpropionate | ChEBI |
| ethyl 4-oxobutyrate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1756021 | Reaxys |
| CAS:10138-10-0 | ChemIDplus |