EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16265 - succinic semialdehyde
| Formula | C4H6O3 |
| Net Charge | 0 |
| Average Mass | 102.089 |
| Monoisotopic Mass | 102.03169 |
| SMILES | [H]C(=O)CCC(=O)O |
| InChI | InChI=1S/C4H6O3/c5-3-1-2-4(6)7/h3H,1-2H2,(H,6,7) |
| InChIKey | UIUJIQZEACWQSV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| succinic semialdehyde (CHEBI:16265) has role Escherichia coli metabolite (CHEBI:76971) |
| succinic semialdehyde (CHEBI:16265) has role mouse metabolite (CHEBI:75771) |
| succinic semialdehyde (CHEBI:16265) is a aldehydic acid (CHEBI:26643) |
| succinic semialdehyde (CHEBI:16265) is conjugate acid of 4-oxobutanoate (CHEBI:57706) |
| Incoming Relation(s) |
| ethyl 4-oxobutanoate (CHEBI:87282) has functional parent succinic semialdehyde (CHEBI:16265) |
| 4-oxobutanoate (CHEBI:57706) is conjugate base of succinic semialdehyde (CHEBI:16265) |
| IUPAC Name |
|---|
| 4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| 3-formylpropanoic acid | ChemIDplus |
| 3-formylpropionic acid | ChemIDplus |
| 4-Oxobutanoate | KEGG COMPOUND |
| semialdéhyde succinique | ChEBI |
| succinaldehydic acid | ChemIDplus |
| Succinate semialdehyde | KEGG COMPOUND |