EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18F3NO.HCl |
| Net Charge | 0 |
| Average Mass | 345.792 |
| Monoisotopic Mass | 345.11073 |
| SMILES | CNCC[C@@H](Oc1ccc(C(F)(F)F)cc1)c1ccccc1.Cl |
| InChI | InChI=1S/C17H18F3NO.ClH/c1-21-12-11-16(13-5-3-2-4-6-13)22-15-9-7-14(8-10-15)17(18,19)20;/h2-10,16,21H,11-12H2,1H3;1H/t16-;/m1./s1 |
| InChIKey | GIYXAJPCNFJEHY-PKLMIRHRSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-fluoxetine hydrochloride (CHEBI:86996) has part (R)-fluoxetine(1+) (CHEBI:86993) |
| (R)-fluoxetine hydrochloride (CHEBI:86996) has role antidepressant (CHEBI:35469) |
| (R)-fluoxetine hydrochloride (CHEBI:86996) has role serotonin uptake inhibitor (CHEBI:50949) |
| (R)-fluoxetine hydrochloride (CHEBI:86996) is a hydrochloride (CHEBI:36807) |
| (R)-fluoxetine hydrochloride (CHEBI:86996) is enantiomer of (S)-fluoxetine hydrochloride (CHEBI:86997) |
| Incoming Relation(s) |
| fluoxetine hydrochloride (CHEBI:5119) has part (R)-fluoxetine hydrochloride (CHEBI:86996) |
| (S)-fluoxetine hydrochloride (CHEBI:86997) is enantiomer of (R)-fluoxetine hydrochloride (CHEBI:86996) |
| IUPAC Name |
|---|
| (3R)-N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine hydrochloride |
| Synonyms | Source |
|---|---|
| (3R)-N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-aminium chloride | IUPAC |
| (−)-fluoxetine hydrochloride | ChEBI |
| (R)-fluoxetine HCl | ChEBI |
| (R)-(−)-fluoxetine hydrochloride | ChEBI |
| (−)-(R)-fluoxetine hydrochloride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:114247-09-5 | ChemIDplus |