EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13ClN4 |
| Net Charge | 0 |
| Average Mass | 248.717 |
| Monoisotopic Mass | 248.08287 |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN4/c1-2-9-10(11(14)17-12(15)16-9)7-3-5-8(13)6-4-7/h3-6H,2H2,1H3,(H4,14,15,16,17) |
| InChIKey | WKSAUQYGYAYLPV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. EC 1.5.1.3 (dihydrofolate reductase) inhibitor An EC 1.5.1.* (oxidoreductase acting on donor CH-NH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of dihydrofolate reductase (EC 1.5.1.3). antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrimethamine (CHEBI:8673) has role antimalarial (CHEBI:38068) |
| pyrimethamine (CHEBI:8673) has role antiprotozoal drug (CHEBI:35820) |
| pyrimethamine (CHEBI:8673) has role EC 1.5.1.3 (dihydrofolate reductase) inhibitor (CHEBI:50683) |
| pyrimethamine (CHEBI:8673) is a aminopyrimidine (CHEBI:38338) |
| pyrimethamine (CHEBI:8673) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine |
| INNs | Source |
|---|---|
| pirimetamina | ChemIDplus |
| pyrimethamine | ChemIDplus |
| pyriméthamine | WHO MedNet |
| pyrimethaminum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,4-Diamino-5-(4-chlorophenyl)-6-ethylpyrimidine | ChemIDplus |
| 2,4-Diamino-5-chlorophenyl-6-ethylpyrimidine | ChemIDplus |
| 2,4-Diamino-5-(p-chlorophenyl)-6-ethylpyrimidine | ChemIDplus |
| 5-(4'-Chlorophenyl)-2,4-diamino-6-ethylpyrimidine | ChemIDplus |
| 5-(4-Chlorophenyl)-6-ethyl-2,4-diaminopyrimidine | ChemIDplus |
| 5-(4-Chlorophenyl)-6-ethyl-2,4-pyrimidinediamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1912 | VSDB |
| C07391 | KEGG COMPOUND |
| CP6 | PDBeChem |
| D00488 | KEGG DRUG |
| DB00205 | DrugBank |
| HMDB0014350 | HMDB |
| LSM-3967 | LINCS |
| Pyrimethamine | Wikipedia |
| Citations |
|---|