EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13ClN4 |
| Net Charge | 0 |
| Average Mass | 248.717 |
| Monoisotopic Mass | 248.08287 |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN4/c1-2-9-10(11(14)17-12(15)16-9)7-3-5-8(13)6-4-7/h3-6H,2H2,1H3,(H4,14,15,16,17) |
| InChIKey | WKSAUQYGYAYLPV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.5.1.3 (dihydrofolate reductase) inhibitor An EC 1.5.1.* (oxidoreductase acting on donor CH-NH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of dihydrofolate reductase (EC 1.5.1.3). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antiparasitic agent A substance used to treat or prevent parasitic infections. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrimethamine (CHEBI:8673) has role anti-anaemic agent (CHEBI:75835) |
| pyrimethamine (CHEBI:8673) has role anti-HIV agent (CHEBI:64946) |
| pyrimethamine (CHEBI:8673) has role antidepressant (CHEBI:35469) |
| pyrimethamine (CHEBI:8673) has role antifungal agent (CHEBI:35718) |
| pyrimethamine (CHEBI:8673) has role antimalarial (CHEBI:38068) |
| pyrimethamine (CHEBI:8673) has role antineoplastic agent (CHEBI:35610) |
| pyrimethamine (CHEBI:8673) has role antiparasitic agent (CHEBI:35442) |
| pyrimethamine (CHEBI:8673) has role antiprotozoal drug (CHEBI:35820) |
| pyrimethamine (CHEBI:8673) has role antipsychotic agent (CHEBI:35476) |
| pyrimethamine (CHEBI:8673) has role EC 1.5.1.3 (dihydrofolate reductase) inhibitor (CHEBI:50683) |
| pyrimethamine (CHEBI:8673) is a aminopyrimidine (CHEBI:38338) |
| pyrimethamine (CHEBI:8673) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine |
| INNs | Source |
|---|---|
| pirimetamina | ChemIDplus |
| pyrimethamine | ChemIDplus |
| pyriméthamine | WHO MedNet |
| pyrimethaminum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,4-Diamino-5-(4-chlorophenyl)-6-ethylpyrimidine | ChemIDplus |
| 2,4-Diamino-5-chlorophenyl-6-ethylpyrimidine | ChemIDplus |
| 2,4-Diamino-5-(p-chlorophenyl)-6-ethylpyrimidine | ChemIDplus |
| 5-(4'-Chlorophenyl)-2,4-diamino-6-ethylpyrimidine | ChemIDplus |
| 5-(4-Chlorophenyl)-6-ethyl-2,4-diaminopyrimidine | ChemIDplus |
| 5-(4-Chlorophenyl)-6-ethyl-2,4-pyrimidinediamine | ChemIDplus |
| Brand Names | Source |
|---|---|
| Daraprim | ChEMBL |
| Malacide | ChEMBL |
| Pyrimethamine component of fansidar | ChEMBL |
| Citations |
|---|