EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8653 - pyocyanine
| Formula | C13H10N2O |
| Net Charge | 0 |
| Average Mass | 210.236 |
| Monoisotopic Mass | 210.07931 |
| SMILES | C[n+]1c2ccccc2nc2c([O-])cccc21 |
| InChI | InChI=1S/C13H10N2O/c1-15-10-6-3-2-5-9(10)14-13-11(15)7-4-8-12(13)16/h2-8H,1H3 |
| InChIKey | YNCMLFHHXWETLD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas aeruginosa (ncbitaxon:287) | - | Article (Z. Physiol. Chem., 1924, v140, 1) | Isolated from broth culture |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. virulence factor Any toxin secreted by bacteria, viruses, fungi or protozoa enabling them to achieve colonisation of a niche in the host, inhibit or evade the host's immune response, enter and exit cells, or obtain nutrition from the host. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyocyanine (CHEBI:8653) has role antibacterial agent (CHEBI:33282) |
| pyocyanine (CHEBI:8653) has role bacterial metabolite (CHEBI:76969) |
| pyocyanine (CHEBI:8653) has role biological pigment (CHEBI:26130) |
| pyocyanine (CHEBI:8653) has role virulence factor (CHEBI:72316) |
| pyocyanine (CHEBI:8653) is a iminium betaine (CHEBI:35285) |
| pyocyanine (CHEBI:8653) is a phenazines (CHEBI:39201) |
| pyocyanine (CHEBI:8653) is conjugate base of pyocyanine(1+) (CHEBI:62220) |
| Incoming Relation(s) |
| pyocyanine(1+) (CHEBI:62220) is conjugate acid of pyocyanine (CHEBI:8653) |
| IUPAC Name |
|---|
| 5-methylphenazin-5-ium-1-olate |
| Synonym | Source |
|---|---|
| pyocyanin | ChEBI |
| Citations |
|---|