EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C37H29N3 |
| Net Charge | +1 |
| Average Mass | 516.668 |
| Monoisotopic Mass | 516.24342 |
| SMILES | C1=CC(=C(c2ccc(Nc3ccccc3)cc2)c2ccc(Nc3ccccc3)cc2)C=CC1=Nc1ccccc1.[H+] |
| InChI | InChI=1S/C37H29N3/c1-4-10-31(11-5-1)38-34-22-16-28(17-23-34)37(29-18-24-35(25-19-29)39-32-12-6-2-7-13-32)30-20-26-36(27-21-30)40-33-14-8-3-9-15-33/h1-27,38-39H/p+1 |
| InChIKey | MIIMIZNJMPQNKO-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spirit blue(1+) (CHEBI:86495) is a organic cation (CHEBI:25697) |
| spirit blue(1+) (CHEBI:86495) is conjugate acid of spirit blue base (CHEBI:86491) |
| Incoming Relation(s) |
| spirit blue (CHEBI:86483) has part spirit blue(1+) (CHEBI:86495) |
| spirit blue base (CHEBI:86491) is conjugate base of spirit blue(1+) (CHEBI:86495) |
| Synonym | Source |
|---|---|
| spirit blue cation | ChEBI |