EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H29N3 |
| Net Charge | 0 |
| Average Mass | 515.660 |
| Monoisotopic Mass | 515.23615 |
| SMILES | C1=CC(=C(c2ccc(Nc3ccccc3)cc2)c2ccc(Nc3ccccc3)cc2)C=CC1=Nc1ccccc1 |
| InChI | InChI=1S/C37H29N3/c1-4-10-31(11-5-1)38-34-22-16-28(17-23-34)37(29-18-24-35(25-19-29)39-32-12-6-2-7-13-32)30-20-26-36(27-21-30)40-33-14-8-3-9-15-33/h1-27,38-39H |
| InChIKey | MIIMIZNJMPQNKO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spirit blue base (CHEBI:86491) has role dye (CHEBI:37958) |
| spirit blue base (CHEBI:86491) is a aromatic amine (CHEBI:33860) |
| spirit blue base (CHEBI:86491) is a imine (CHEBI:24783) |
| spirit blue base (CHEBI:86491) is a olefinic compound (CHEBI:78840) |
| spirit blue base (CHEBI:86491) is a secondary amino compound (CHEBI:50995) |
| spirit blue base (CHEBI:86491) is conjugate base of spirit blue(1+) (CHEBI:86495) |
| Incoming Relation(s) |
| spirit blue(1+) (CHEBI:86495) is conjugate acid of spirit blue base (CHEBI:86491) |
| IUPAC Name |
|---|
| N,N'-[{[4-(phenylimino)cyclohexa-2,5-dien-1-ylidene]methylene}di(4,1-phenylene)]dianiline |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2792073 | Reaxys |
| CAS:22244-16-2 | ChemIDplus |