EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N2O2 |
| Net Charge | 0 |
| Average Mass | 340.467 |
| Monoisotopic Mass | 340.21508 |
| SMILES | [H][C@@]1([C@H](O)c2ccnc3ccc(OCC)cc23)C[C@@H]2CC[N@@]1C[C@@H]2CC |
| InChI | InChI=1S/C21H28N2O2/c1-3-14-13-23-10-8-15(14)11-20(23)21(24)17-7-9-22-19-6-5-16(25-4-2)12-18(17)19/h5-7,9,12,14-15,20-21,24H,3-4,8,10-11,13H2,1-2H3/t14-,15-,20-,21+/m0/s1 |
| InChIKey | SUWZHLCNFQWNPE-LATRNWQMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that inhibits H+/K+-exchanging ATPase, EC 3.6.3.10. Such compounds are also known as proton pump inhibitors. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| optochin (CHEBI:86455) has functional parent cinchonan (CHEBI:35933) |
| optochin (CHEBI:86455) has role EC 3.6.3.10 (H+/K+-exchanging ATPase) inhibitor (CHEBI:49200) |
| optochin (CHEBI:86455) is a aromatic ether (CHEBI:35618) |
| optochin (CHEBI:86455) is a cinchona alkaloid (CHEBI:51323) |
| IUPAC Name |
|---|
| (8α,9R)-6'-ethoxy-10,11-dihydrocinchonan-9-ol |
| Synonyms | Source |
|---|---|
| Ethylhydrocupreine | ChemIDplus |
| Hydrocupreine ethyl ether | ChemIDplus |
| Optoquine | ChemIDplus |
| Citations |
|---|