EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2 |
| Net Charge | 0 |
| Average Mass | 278.399 |
| Monoisotopic Mass | 278.17830 |
| SMILES | C=C[C@H]1C[N@]2CC[C@H]1C[C@@H]2Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C19H22N2/c1-2-14-13-21-10-8-15(14)11-17(21)12-16-7-9-20-19-6-4-3-5-18(16)19/h2-7,9,14-15,17H,1,8,10-13H2/t14-,15-,17+/m0/s1 |
| InChIKey | UFJOYVQIDSNLHC-YQQAZPJKSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinchonan (CHEBI:35933) is a (8ξ)-cinchonan (CHEBI:59137) |
| cinchonan (CHEBI:35933) is a cinchona alkaloid (CHEBI:51323) |
| cinchonan (CHEBI:35933) is a quinoline alkaloid fundamental parent (CHEBI:38514) |
| cinchonan (CHEBI:35933) is a quinuclidines (CHEBI:26518) |
| Incoming Relation(s) |
| optochin (CHEBI:86455) has functional parent cinchonan (CHEBI:35933) |
| cinchonine (CHEBI:27509) has parent hydride cinchonan (CHEBI:35933) |
| cupreine (CHEBI:28582) has parent hydride cinchonan (CHEBI:35933) |
| quinidine (CHEBI:28593) has parent hydride cinchonan (CHEBI:35933) |
| IUPAC Name |
|---|
| cinchonan |
| Registry Numbers | Sources |
|---|---|
| Beilstein:88420 | Beilstein |