EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N5O9P |
| Net Charge | 0 |
| Average Mass | 467.331 |
| Monoisotopic Mass | 467.08421 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OC(=O)c2ccc(O)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H18N5O9P/c18-14-11-15(20-6-19-14)22(7-21-11)16-13(25)12(24)10(30-16)5-29-32(27,28)31-17(26)8-1-3-9(23)4-2-8/h1-4,6-7,10,12-13,16,23-25H,5H2,(H,27,28)(H2,18,19,20)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | DMJCKNFAONBFQI-XNIJJKJLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxybenzoyl-AMP (CHEBI:86433) has functional parent 4-hydroxybenzoic acid (CHEBI:30763) |
| 4-hydroxybenzoyl-AMP (CHEBI:86433) has functional parent adenosine 5'-monophosphate (CHEBI:16027) |
| 4-hydroxybenzoyl-AMP (CHEBI:86433) is a acyclic mixed acid anhydride (CHEBI:37787) |
| 4-hydroxybenzoyl-AMP (CHEBI:86433) is a purine ribonucleoside 5'-monophosphate (CHEBI:37021) |
| 4-hydroxybenzoyl-AMP (CHEBI:86433) is conjugate acid of 4-hydroxybenzoyl-AMP(1−) (CHEBI:86435) |
| Incoming Relation(s) |
| 4-hydroxybenzoyl-AMP(1−) (CHEBI:86435) is conjugate base of 4-hydroxybenzoyl-AMP (CHEBI:86433) |
| IUPAC Name |
|---|
| 5'-O-{hydroxy[(4-hydroxybenzoyl)oxy]phosphoryl}adenosine |
| Synonym | Source |
|---|---|
| 4-hydroxybenzoyl adenylate | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23982064 | Reaxys |