EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O4 |
| Net Charge | 0 |
| Average Mass | 120.104 |
| Monoisotopic Mass | 120.04226 |
| SMILES | C[C@@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C4H8O4/c1-2(5)3(6)4(7)8/h2-3,5-6H,1H3,(H,7,8)/t2-,3+/m1/s1 |
| InChIKey | LOUGYXZSURQALL-GBXIJSLDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-deoxythreonic acid (CHEBI:86391) has role human urinary metabolite (CHEBI:84087) |
| 4-deoxythreonic acid (CHEBI:86391) is a 2,3-dihydroxybutanoic acid (CHEBI:86347) |
| IUPAC Name |
|---|
| (2S,3R)-2,3-dihydroxybutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002453 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721658 | Reaxys |
| Citations |
|---|