EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O4 |
| Net Charge | 0 |
| Average Mass | 120.104 |
| Monoisotopic Mass | 120.04226 |
| SMILES | CC(O)C(O)C(=O)O |
| InChI | InChI=1S/C4H8O4/c1-2(5)3(6)4(7)8/h2-3,5-6H,1H3,(H,7,8) |
| InChIKey | LOUGYXZSURQALL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1007/s11306-014-0642-1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydroxybutanoic acid (CHEBI:86347) has role human metabolite (CHEBI:77746) |
| 2,3-dihydroxybutanoic acid (CHEBI:86347) is a hydroxybutyric acid (CHEBI:24684) |
| Incoming Relation(s) |
| 4-deoxythreonic acid (CHEBI:86391) is a 2,3-dihydroxybutanoic acid (CHEBI:86347) |
| IUPAC Name |
|---|
| 2,3-dihydroxybutanoic acid |
| Synonym | Source |
|---|---|
| 4-deoxy-erythronic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050397 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721655 | Reaxys |