EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N4 |
| Net Charge | 0 |
| Average Mass | 252.321 |
| Monoisotopic Mass | 252.13750 |
| SMILES | Cc1cc2nc3ccc(N(C)C)cc3nc2cc1N |
| InChI | InChI=1S/C15H16N4/c1-9-6-13-15(8-11(9)16)18-14-7-10(19(2)3)4-5-12(14)17-13/h4-8H,16H2,1-3H3 |
| InChIKey | GLVRJEJEXGVOMJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | two-colour indicator A colour indicator that possesses a different colour on each side of the transition interval. acid-base indicator An acid or base which exhibits a colour change on neutralization by the basic or acidic titrant at or near the equivalence point of a titration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neutral red base (CHEBI:86372) has role acid-base indicator (CHEBI:50407) |
| neutral red base (CHEBI:86372) has role dye (CHEBI:37958) |
| neutral red base (CHEBI:86372) has role two-colour indicator (CHEBI:50412) |
| neutral red base (CHEBI:86372) is a aromatic amine (CHEBI:33860) |
| neutral red base (CHEBI:86372) is a phenazines (CHEBI:39201) |
| neutral red base (CHEBI:86372) is a primary amino compound (CHEBI:50994) |
| neutral red base (CHEBI:86372) is a tertiary amino compound (CHEBI:50996) |
| neutral red base (CHEBI:86372) is conjugate base of neutral red(1+) (CHEBI:86373) |
| Incoming Relation(s) |
| neutral red(1+) (CHEBI:86373) is conjugate acid of neutral red base (CHEBI:86372) |
| IUPAC Name |
|---|
| N8,N8,3-trimethylphenazine-2,8-diamine |
| Synonyms | Source |
|---|---|
| 3-amino-7-dimethylamino-2-methylphenazine | ChEBI |
| C.I. Basic Red 5, free base | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Neutral_red | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22518 | Reaxys |
| CAS:366-13-2 | ChemIDplus |