EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H4O3 |
| Net Charge | 0 |
| Average Mass | 88.062 |
| Monoisotopic Mass | 88.01604 |
| SMILES | C=C(O)C(=O)O |
| InChI | InChI=1S/C3H4O3/c1-2(4)3(5)6/h4H,1H2,(H,5,6) |
| InChIKey | FEWFXBUNENSNBQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1007/s11306-014-0642-1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyacrylic acid (CHEBI:86354) has functional parent acrylic acid (CHEBI:18308) |
| 2-hydroxyacrylic acid (CHEBI:86354) has role human metabolite (CHEBI:77746) |
| 2-hydroxyacrylic acid (CHEBI:86354) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| 2-hydroxyprop-2-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1920699 | Reaxys |