EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11O8P |
| Net Charge | 0 |
| Average Mass | 230.109 |
| Monoisotopic Mass | 230.01915 |
| SMILES | O=P(O)(O)OC[C@H]1OC(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H11O8P/c6-3-2(1-12-14(9,10)11)13-5(8)4(3)7/h2-8H,1H2,(H2,9,10,11)/t2-,3-,4+,5?/m1/s1 |
| InChIKey | KTVPXOYAKDPRHY-ZRMNMSDTSA-N |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-arabinofuranose 5-phosphate (CHEBI:86279) has functional parent D-arabinofuranose (CHEBI:79054) |
| D-arabinofuranose 5-phosphate (CHEBI:86279) is a D-arabinose 5-phosphate (CHEBI:79058) |
| D-arabinofuranose 5-phosphate (CHEBI:86279) is conjugate acid of D-arabinofuranose 5-phosphate(2−) (CHEBI:85971) |
| Incoming Relation(s) |
| D-arabinofuranose 5-phosphate(2−) (CHEBI:85971) is conjugate base of D-arabinofuranose 5-phosphate (CHEBI:86279) |
| IUPAC Names |
|---|
| D-arabinofuranose 5-(dihydrogen phosphate) |
| 5-O-phosphono-D-arabinofuranose |
| Synonym | Source |
|---|---|
| D-arabinofuranose 5-monophosphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2333180 | Reaxys |