EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | OC[C@H]1OC(O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a122h-1x_1-4]/1/ |
| InChI | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4+,5?/m1/s1 |
| InChIKey | HMFHBZSHGGEWLO-ZRMNMSDTSA-N |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). fundamental metabolite Any metabolite produced by all living cells. fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-arabinofuranose (CHEBI:79054) is a D-arabinose (CHEBI:17108) |
| D-arabinofuranose (CHEBI:79054) is enantiomer of L-arabinofuranose (CHEBI:6178) |
| Incoming Relation(s) |
| D-arabinofuranose 5-phosphate (CHEBI:86279) has functional parent D-arabinofuranose (CHEBI:79054) |
| D-Manp-(1→2)-D-Araf (CHEBI:148278) has functional parent D-arabinofuranose (CHEBI:79054) |
| D-Manp-(1→5)-D-Araf (CHEBI:151463) has functional parent D-arabinofuranose (CHEBI:79054) |
| α-D-arabinofuranose (CHEBI:145590) is a D-arabinofuranose (CHEBI:79054) |
| β-D-arabinofuranose (CHEBI:79055) is a D-arabinofuranose (CHEBI:79054) |
| L-arabinofuranose (CHEBI:6178) is enantiomer of D-arabinofuranose (CHEBI:79054) |
| IUPAC Name |
|---|
| D-arabinofuranose |
| UniProt Name | Source |
|---|---|
| D-arabinofuranose | UniProt |
| Manual Xrefs | Databases |
|---|---|
| G26886DA | GlyTouCan |