EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CC(C)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C6H13NO2/c1-4(2)5(7)3-6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | GLUJNGJDHCTUJY-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-β-leucine (CHEBI:86261) is a β-leucine (CHEBI:72772) |
| (3S)-β-leucine (CHEBI:86261) is enantiomer of (3R)-β-leucine (CHEBI:15604) |
| Incoming Relation(s) |
| (3R)-β-leucine (CHEBI:15604) is enantiomer of (3S)-β-leucine (CHEBI:86261) |
| IUPAC Name |
|---|
| (3S)-3-amino-4-methylpentanoic acid |
| Synonym | Source |
|---|---|
| (S)-homo-β-val | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0003640 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8308744 | Reaxys |