EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CC(C)C(N)CC(=O)O |
| InChI | InChI=1S/C6H13NO2/c1-4(2)5(7)3-6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) |
| InChIKey | GLUJNGJDHCTUJY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-leucine (CHEBI:72772) has role human metabolite (CHEBI:77746) |
| β-leucine (CHEBI:72772) is a β-amino acid (CHEBI:33706) |
| Incoming Relation(s) |
| (3R)-β-leucine (CHEBI:15604) is a β-leucine (CHEBI:72772) |
| (3S)-β-leucine (CHEBI:86261) is a β-leucine (CHEBI:72772) |
| IUPAC Name |
|---|
| 3-amino-4-methylpentanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721067 | Reaxys |
| CAS:5699-54-7 | ChemIDplus |
| Citations |
|---|