EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9N3O6S2.2Na |
| Net Charge | 0 |
| Average Mass | 401.333 |
| Monoisotopic Mass | 400.97282 |
| SMILES | Nc1ccc(/N=N/c2ccc(S(=O)(=O)[O-])cc2)cc1S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C12H11N3O6S2.2Na/c13-11-6-3-9(7-12(11)23(19,20)21)15-14-8-1-4-10(5-2-8)22(16,17)18;;/h1-7H,13H2,(H,16,17,18)(H,19,20,21);;/q;2*+1/p-2/b15-14+;; |
| InChIKey | FPVGTPBMTFTMRT-NSKUCRDLSA-L |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fast yellow (CHEBI:86126) has part 4-aminoazobenzene-3,4'-disulfonate (CHEBI:86125) |
| fast yellow (CHEBI:86126) has role histological dye (CHEBI:77178) |
| fast yellow (CHEBI:86126) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 2-amino-5-[(E)-(4-sulfonatophenyl)diazenyl]benzenesulfonate |
| Synonyms | Source |
|---|---|
| acetyl yellow | ChEBI |
| acid yellow 9 | ChEBI |
| Acid Yellow AT | ChemIDplus |
| Acid Yellow Geigy | ChemIDplus |
| Acilan Yellow Extra | ChemIDplus |
| Amacid Yellow RG | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:2706-28-7 | ChemIDplus |