EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9N3O6S2 |
| Net Charge | -2 |
| Average Mass | 355.353 |
| Monoisotopic Mass | 354.99437 |
| SMILES | Nc1ccc(/N=N/c2ccc(S(=O)(=O)[O-])cc2)cc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C12H11N3O6S2/c13-11-6-3-9(7-12(11)23(19,20)21)15-14-8-1-4-10(5-2-8)22(16,17)18/h1-7H,13H2,(H,16,17,18)(H,19,20,21)/p-2/b15-14+ |
| InChIKey | DCYBHNIOTZBCFS-CCEZHUSRSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-aminoazobenzene-3,4'-disulfonate (CHEBI:86125) is a organosulfonate oxoanion (CHEBI:33554) |
| 4-aminoazobenzene-3,4'-disulfonate (CHEBI:86125) is conjugate base of 4-aminoazobenzene-3,4'-disulfonic acid (CHEBI:86124) |
| Incoming Relation(s) |
| fast yellow (CHEBI:86126) has part 4-aminoazobenzene-3,4'-disulfonate (CHEBI:86125) |
| 4-aminoazobenzene-3,4'-disulfonic acid (CHEBI:86124) is conjugate acid of 4-aminoazobenzene-3,4'-disulfonate (CHEBI:86125) |
| IUPAC Name |
|---|
| 2-amino-5-[(E)-(4-sulfonatophenyl)diazenyl]benzenesulfonate |