EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O4 |
| Net Charge | 0 |
| Average Mass | 196.202 |
| Monoisotopic Mass | 196.07356 |
| SMILES | [H]C(=Cc1cc(O)c(O)c(OC)c1)CO |
| InChI | InChI=1S/C10H12O4/c1-14-9-6-7(3-2-4-11)5-8(12)10(9)13/h2-3,5-6,11-13H,4H2,1H3 |
| InChIKey | NPNAJGCZQBQWQZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxyconiferyl alcohol (CHEBI:86068) has functional parent cinnamyl alcohol (CHEBI:17177) |
| 5-hydroxyconiferyl alcohol (CHEBI:86068) has role plant metabolite (CHEBI:76924) |
| 5-hydroxyconiferyl alcohol (CHEBI:86068) is a catechols (CHEBI:33566) |
| 5-hydroxyconiferyl alcohol (CHEBI:86068) is a guaiacols (CHEBI:134251) |
| 5-hydroxyconiferyl alcohol (CHEBI:86068) is a phenylpropanoid (CHEBI:26004) |
| Incoming Relation(s) |
| (E)-5-hydroxyconiferyl alcohol (CHEBI:31135) is a 5-hydroxyconiferyl alcohol (CHEBI:86068) |
| IUPAC Name |
|---|
| 5-(3-hydroxyprop-1-en-1-yl)-3-methoxybenzene-1,2-diol |
| Manual Xrefs | Databases |
|---|---|
| 5-HYDROXY-CONIFERYL-ALCOHOL | MetaCyc |
| C00007337 | KNApSAcK |
| C12205 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2617914 | Reaxys |
| CAS:1782-47-4 | KEGG COMPOUND |
| Citations |
|---|