EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O4 |
| Net Charge | 0 |
| Average Mass | 196.202 |
| Monoisotopic Mass | 196.07356 |
| SMILES | COc1cc(/C=C/CO)cc(O)c1O |
| InChI | InChI=1S/C10H12O4/c1-14-9-6-7(3-2-4-11)5-8(12)10(9)13/h2-3,5-6,11-13H,4H2,1H3/b3-2+ |
| InChIKey | NPNAJGCZQBQWQZ-NSCUHMNNSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-5-hydroxyconiferyl alcohol (CHEBI:31135) has functional parent (E)-cinnamyl alcohol (CHEBI:33227) |
| (E)-5-hydroxyconiferyl alcohol (CHEBI:31135) is a 5-hydroxyconiferyl alcohol (CHEBI:86068) |
| IUPAC Name |
|---|
| 5-[(1E)-3-hydroxyprop-1-en-1-yl]-3-methoxybenzene-1,2-diol |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060398 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7281809 | Reaxys |
| Citations |
|---|