EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10O5 |
| Net Charge | 0 |
| Average Mass | 282.251 |
| Monoisotopic Mass | 282.05282 |
| SMILES | O=c1c(-c2ccc3c(c2)OCO3)coc2cc(O)ccc12 |
| InChI | InChI=1S/C16H10O5/c17-10-2-3-11-14(6-10)19-7-12(16(11)18)9-1-4-13-15(5-9)21-8-20-13/h1-7,17H,8H2 |
| InChIKey | KNJNBKINYHZUGC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Application: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pseudobaptigenin (CHEBI:8602) has role antiprotozoal drug (CHEBI:35820) |
| pseudobaptigenin (CHEBI:8602) has role plant metabolite (CHEBI:76924) |
| pseudobaptigenin (CHEBI:8602) is a 7-hydroxyisoflavones (CHEBI:55465) |
| pseudobaptigenin (CHEBI:8602) is a benzodioxoles (CHEBI:38298) |
| pseudobaptigenin (CHEBI:8602) is conjugate acid of pseudobaptigenin(1−) (CHEBI:78327) |
| Incoming Relation(s) |
| 2',7-dihydroxy-4',5'-methylenedioxyisoflavone (CHEBI:80393) has functional parent pseudobaptigenin (CHEBI:8602) |
| 5-hydroxypseudobaptigenin (CHEBI:61312) has functional parent pseudobaptigenin (CHEBI:8602) |
| pseudobaptigenin(1−) (CHEBI:78327) is conjugate base of pseudobaptigenin (CHEBI:8602) |
| IUPAC Name |
|---|
| 3-(1,3-benzodioxol-5-yl)-7-hydroxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| ψ-baptigenin | ChemIDplus |
| 7-hydroxy-3',4'-(methylenedioxy)isoflavone | ChEBI |
| pseudobaptisin aglycone | ChEBI |
| 3-(1,3-benzodioxol-5-yl)-7-hydroxy-4H-1-benzopyran-4-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10522 | KEGG COMPOUND |
| CPD-3628 | MetaCyc |
| LMPK12050053 | LIPID MAPS |
| Pseudobaptigenin | Wikipedia |
| HMDB0036616 | HMDB |
| WO9949862 | Patent |
| C00002565 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:290453 | Reaxys |
| CAS:90-29-9 | KEGG COMPOUND |
| CAS:90-29-9 | ChemIDplus |
| Citations |
|---|