EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H9O5 |
| Net Charge | -1 |
| Average Mass | 281.243 |
| Monoisotopic Mass | 281.04555 |
| SMILES | O=c1c(-c2ccc3c(c2)OCO3)coc2cc([O-])ccc12 |
| InChI | InChI=1S/C16H10O5/c17-10-2-3-11-14(6-10)19-7-12(16(11)18)9-1-4-13-15(5-9)21-8-20-13/h1-7,17H,8H2/p-1 |
| InChIKey | KNJNBKINYHZUGC-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pseudobaptigenin(1−) (CHEBI:78327) has role antiprotozoal drug (CHEBI:35820) |
| pseudobaptigenin(1−) (CHEBI:78327) has role plant metabolite (CHEBI:76924) |
| pseudobaptigenin(1−) (CHEBI:78327) is a flavonoid oxoanion (CHEBI:60038) |
| pseudobaptigenin(1−) (CHEBI:78327) is conjugate base of pseudobaptigenin (CHEBI:8602) |
| Incoming Relation(s) |
| pseudobaptigenin (CHEBI:8602) is conjugate acid of pseudobaptigenin(1−) (CHEBI:78327) |
| IUPAC Name |
|---|
| 3-(1,3-benzodioxol-5-yl)-4-oxo-4H-chromen-7-olate |
| UniProt Name | Source |
|---|---|
| pseudobaptigenin | UniProt |