EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19ClN4O4.CH4O3S |
| Net Charge | 0 |
| Average Mass | 522.967 |
| Monoisotopic Mass | 522.09760 |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)NC4CC4)c(Cl)c3)c2cc1C(N)=O.CS(=O)(=O)O |
| InChI | InChI=1S/C21H19ClN4O4.CH4O3S/c1-29-19-10-17-13(9-14(19)20(23)27)18(6-7-24-17)30-12-4-5-16(15(22)8-12)26-21(28)25-11-2-3-11;1-5(2,3)4/h4-11H,2-3H2,1H3,(H2,23,27)(H2,25,26,28);1H3,(H,2,3,4) |
| InChIKey | HWLFIUUAYLEFCT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). fibroblast growth factor receptor antagonist An antagonist at the fibroblast growth factor receptor. vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lenvatinib mesylate (CHEBI:85995) has part lenvatinib(1+) (CHEBI:85998) |
| lenvatinib mesylate (CHEBI:85995) has role antineoplastic agent (CHEBI:35610) |
| lenvatinib mesylate (CHEBI:85995) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| lenvatinib mesylate (CHEBI:85995) has role fibroblast growth factor receptor antagonist (CHEBI:63457) |
| lenvatinib mesylate (CHEBI:85995) has role orphan drug (CHEBI:71031) |
| lenvatinib mesylate (CHEBI:85995) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| lenvatinib mesylate (CHEBI:85995) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Names |
|---|
| 6-carbamoyl-4-{3-chloro-4-[(cyclopropylcarbamoyl)amino]phenoxy}-7-methoxyquinolin-1-ium methanesulfonate |
| methanesulfonic acid—4-{3-chloro-4-[(cyclopropylcarbamoyl)amino]phenoxy}-7-methoxyquinoline-6-carboxamide (1/1) |
| Synonyms | Source |
|---|---|
| E7080 | ChemIDplus |
| Lenvatinib mesilate | KEGG DRUG |
| N-(4-((6-Carbamoyl-7-methoxyquinolin-4-yl)oxy)-2-chlorophenyl)-N'-cyclopropylurea monomethanesulfonate | ChemIDplus |
| UNII-3J78384F61 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Lenvima | KEGG DRUG |
| Lenvima | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D09920 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14616854 | Reaxys |
| CAS:857890-39-2 | ChemIDplus |
| CAS:857890-39-2 | KEGG DRUG |
| Citations |
|---|