EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19ClN4O4.CH4O3S |
| Net Charge | 0 |
| Average Mass | 522.967 |
| Monoisotopic Mass | 522.09760 |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)NC4CC4)c(Cl)c3)c2cc1C(N)=O.CS(=O)(=O)O |
| InChI | InChI=1S/C21H19ClN4O4.CH4O3S/c1-29-19-10-17-13(9-14(19)20(23)27)18(6-7-24-17)30-12-4-5-16(15(22)8-12)26-21(28)25-11-2-3-11;1-5(2,3)4/h4-11H,2-3H2,1H3,(H2,23,27)(H2,25,26,28);1H3,(H,2,3,4) |
| InChIKey | HWLFIUUAYLEFCT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | fibroblast growth factor receptor antagonist An antagonist at the fibroblast growth factor receptor. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lenvatinib mesylate (CHEBI:85995) has part lenvatinib(1+) (CHEBI:85998) |
| lenvatinib mesylate (CHEBI:85995) has role antineoplastic agent (CHEBI:35610) |
| lenvatinib mesylate (CHEBI:85995) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| lenvatinib mesylate (CHEBI:85995) has role fibroblast growth factor receptor antagonist (CHEBI:63457) |
| lenvatinib mesylate (CHEBI:85995) has role orphan drug (CHEBI:71031) |
| lenvatinib mesylate (CHEBI:85995) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| lenvatinib mesylate (CHEBI:85995) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Names |
|---|
| 6-carbamoyl-4-{3-chloro-4-[(cyclopropylcarbamoyl)amino]phenoxy}-7-methoxyquinolin-1-ium methanesulfonate |
| methanesulfonic acid—4-{3-chloro-4-[(cyclopropylcarbamoyl)amino]phenoxy}-7-methoxyquinoline-6-carboxamide (1/1) |
| Synonyms | Source |
|---|---|
| E7080 | ChemIDplus |
| E-7080 MESYLATE | ChEMBL |
| E7080 MESYLATE | ChEMBL |
| Lenvatinib mesilate | KEGG DRUG |
| Lenvatinib methanesulfonate | ChEMBL |
| N-(4-((6-Carbamoyl-7-methoxyquinolin-4-yl)oxy)-2-chlorophenyl)-N'-cyclopropylurea monomethanesulfonate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Lenvima | KEGG DRUG |
| Lenvima | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D09920 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14616854 | Reaxys |
| CAS:857890-39-2 | ChemIDplus |
| CAS:857890-39-2 | KEGG DRUG |
| Citations |
|---|