EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19ClN4O4 |
| Net Charge | 0 |
| Average Mass | 426.860 |
| Monoisotopic Mass | 426.10948 |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)NC4CC4)c(Cl)c3)c2cc1C(N)=O |
| InChI | InChI=1S/C21H19ClN4O4/c1-29-19-10-17-13(9-14(19)20(23)27)18(6-7-24-17)30-12-4-5-16(15(22)8-12)26-21(28)25-11-2-3-11/h4-11H,2-3H2,1H3,(H2,23,27)(H2,25,26,28) |
| InChIKey | WOSKHXYHFSIKNG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). fibroblast growth factor receptor antagonist An antagonist at the fibroblast growth factor receptor. vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. renoprotective agent Any compound that is able to prevent damage to the kidneys. orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lenvatinib (CHEBI:85994) has role antineoplastic agent (CHEBI:35610) |
| lenvatinib (CHEBI:85994) has role antiviral agent (CHEBI:22587) |
| lenvatinib (CHEBI:85994) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| lenvatinib (CHEBI:85994) has role fibroblast growth factor receptor antagonist (CHEBI:63457) |
| lenvatinib (CHEBI:85994) has role orphan drug (CHEBI:71031) |
| lenvatinib (CHEBI:85994) has role renoprotective agent (CHEBI:231911) |
| lenvatinib (CHEBI:85994) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| lenvatinib (CHEBI:85994) is a aromatic amide (CHEBI:62733) |
| lenvatinib (CHEBI:85994) is a aromatic ether (CHEBI:35618) |
| lenvatinib (CHEBI:85994) is a cyclopropanes (CHEBI:51454) |
| lenvatinib (CHEBI:85994) is a monocarboxylic acid amide (CHEBI:29347) |
| lenvatinib (CHEBI:85994) is a monochlorobenzenes (CHEBI:83403) |
| lenvatinib (CHEBI:85994) is a phenylureas (CHEBI:134043) |
| lenvatinib (CHEBI:85994) is a quinolines (CHEBI:26513) |
| lenvatinib (CHEBI:85994) is conjugate base of lenvatinib(1+) (CHEBI:85998) |
| Incoming Relation(s) |
| lenvatinib(1+) (CHEBI:85998) is conjugate acid of lenvatinib (CHEBI:85994) |
| IUPAC Name |
|---|
| 4-{3-chloro-4-[(cyclopropylcarbamoyl)amino]phenoxy}-7-methoxyquinoline-6-carboxamide |
| INN | Source |
|---|---|
| lenvatinib | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 4-(3-Chloro-4-(N'-cyclopropylureido)phenoxy)-7-methoxyquinoline-6-carboxamide | ChemIDplus |
| E 7080 | ChemIDplus |
| E7080 | ChemIDplus |
| UNII-EE083865G2 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Kisplyx | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4942 | DrugCentral |
| D09919 | KEGG DRUG |
| Lenvatinib | Wikipedia |
| LEV | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12096874 | Reaxys |
| CAS:417716-92-8 | KEGG DRUG |
| CAS:417716-92-8 | ChemIDplus |
| Citations |
|---|