EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19ClN4O4 |
| Net Charge | 0 |
| Average Mass | 426.860 |
| Monoisotopic Mass | 426.10948 |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)NC4CC4)c(Cl)c3)c2cc1C(N)=O |
| InChI | InChI=1S/C21H19ClN4O4/c1-29-19-10-17-13(9-14(19)20(23)27)18(6-7-24-17)30-12-4-5-16(15(22)8-12)26-21(28)25-11-2-3-11/h4-11H,2-3H2,1H3,(H2,23,27)(H2,25,26,28) |
| InChIKey | WOSKHXYHFSIKNG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). fibroblast growth factor receptor antagonist An antagonist at the fibroblast growth factor receptor. |
| Applications: | orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lenvatinib (CHEBI:85994) has role antineoplastic agent (CHEBI:35610) |
| lenvatinib (CHEBI:85994) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| lenvatinib (CHEBI:85994) has role fibroblast growth factor receptor antagonist (CHEBI:63457) |
| lenvatinib (CHEBI:85994) has role orphan drug (CHEBI:71031) |
| lenvatinib (CHEBI:85994) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| lenvatinib (CHEBI:85994) is a aromatic amide (CHEBI:62733) |
| lenvatinib (CHEBI:85994) is a aromatic ether (CHEBI:35618) |
| lenvatinib (CHEBI:85994) is a cyclopropanes (CHEBI:51454) |
| lenvatinib (CHEBI:85994) is a monocarboxylic acid amide (CHEBI:29347) |
| lenvatinib (CHEBI:85994) is a monochlorobenzenes (CHEBI:83403) |
| lenvatinib (CHEBI:85994) is a phenylureas (CHEBI:134043) |
| lenvatinib (CHEBI:85994) is a quinolines (CHEBI:26513) |
| lenvatinib (CHEBI:85994) is conjugate base of lenvatinib(1+) (CHEBI:85998) |
| Incoming Relation(s) |
| lenvatinib(1+) (CHEBI:85998) is conjugate acid of lenvatinib (CHEBI:85994) |
| IUPAC Name |
|---|
| 4-{3-chloro-4-[(cyclopropylcarbamoyl)amino]phenoxy}-7-methoxyquinoline-6-carboxamide |
| INN | Source |
|---|---|
| lenvatinib | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 4-(3-Chloro-4-(N'-cyclopropylureido)phenoxy)-7-methoxyquinoline-6-carboxamide | ChemIDplus |
| E 7080 | ChemIDplus |
| E7080 | ChemIDplus |
| UNII-EE083865G2 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4942 | DrugCentral |
| D09919 | KEGG DRUG |
| Lenvatinib | Wikipedia |
| LEV | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12096874 | Reaxys |
| CAS:417716-92-8 | KEGG DRUG |
| CAS:417716-92-8 | ChemIDplus |
| Citations |
|---|