EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19ClN4O4 |
| Net Charge | 0 |
| Average Mass | 426.860 |
| Monoisotopic Mass | 426.10948 |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)NC4CC4)c(Cl)c3)c2cc1C(N)=O |
| InChI | InChI=1S/C21H19ClN4O4/c1-29-19-10-17-13(9-14(19)20(23)27)18(6-7-24-17)30-12-4-5-16(15(22)8-12)26-21(28)25-11-2-3-11/h4-11H,2-3H2,1H3,(H2,23,27)(H2,25,26,28) |
| InChIKey | WOSKHXYHFSIKNG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. fibroblast growth factor receptor antagonist An antagonist at the fibroblast growth factor receptor. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lenvatinib (CHEBI:85994) has role antineoplastic agent (CHEBI:35610) |
| lenvatinib (CHEBI:85994) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| lenvatinib (CHEBI:85994) has role fibroblast growth factor receptor antagonist (CHEBI:63457) |
| lenvatinib (CHEBI:85994) has role orphan drug (CHEBI:71031) |
| lenvatinib (CHEBI:85994) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| lenvatinib (CHEBI:85994) is a aromatic amide (CHEBI:62733) |
| lenvatinib (CHEBI:85994) is a aromatic ether (CHEBI:35618) |
| lenvatinib (CHEBI:85994) is a cyclopropanes (CHEBI:51454) |
| lenvatinib (CHEBI:85994) is a monocarboxylic acid amide (CHEBI:29347) |
| lenvatinib (CHEBI:85994) is a monochlorobenzenes (CHEBI:83403) |
| lenvatinib (CHEBI:85994) is a phenylureas (CHEBI:134043) |
| lenvatinib (CHEBI:85994) is a quinolines (CHEBI:26513) |
| lenvatinib (CHEBI:85994) is conjugate base of lenvatinib(1+) (CHEBI:85998) |
| Incoming Relation(s) |
| lenvatinib(1+) (CHEBI:85998) is conjugate acid of lenvatinib (CHEBI:85994) |
| IUPAC Name |
|---|
| 4-{3-chloro-4-[(cyclopropylcarbamoyl)amino]phenoxy}-7-methoxyquinoline-6-carboxamide |
| INN | Source |
|---|---|
| lenvatinib | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 4-(3-Chloro-4-(N'-cyclopropylureido)phenoxy)-7-methoxyquinoline-6-carboxamide | ChemIDplus |
| E 7080 | ChemIDplus |
| E7080 | ChemIDplus |
| UNII-EE083865G2 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4942 | DrugCentral |
| D09919 | KEGG DRUG |
| Lenvatinib | Wikipedia |
| LEV | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12096874 | Reaxys |
| CAS:417716-92-8 | KEGG DRUG |
| CAS:417716-92-8 | ChemIDplus |
| Citations |
|---|