EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H37N2O5 |
| Net Charge | +1 |
| Average Mass | 469.602 |
| Monoisotopic Mass | 469.26970 |
| SMILES | COc1cc2c(cc1OC)CC(=O)N(CCC[NH+](C)C[C@H]1Cc3cc(OC)c(OC)cc31)CC2 |
| InChI | InChI=1S/C27H36N2O5/c1-28(17-21-11-20-14-25(33-4)26(34-5)16-22(20)21)8-6-9-29-10-7-18-12-23(31-2)24(32-3)13-19(18)15-27(29)30/h12-14,16,21H,6-11,15,17H2,1-5H3/p+1/t21-/m1/s1 |
| InChIKey | ACRHBAYQBXXRTO-OAQYLSRUSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ivabradine(1+) (CHEBI:85972) is a ammonium ion derivative (CHEBI:35274) |
| ivabradine(1+) (CHEBI:85972) is a organic cation (CHEBI:25697) |
| ivabradine(1+) (CHEBI:85972) is conjugate acid of ivabradine (CHEBI:85966) |
| Incoming Relation(s) |
| ivabradine hydrochloride (CHEBI:85969) has part ivabradine(1+) (CHEBI:85972) |
| ivabradine (CHEBI:85966) is conjugate base of ivabradine(1+) (CHEBI:85972) |
| IUPAC Name |
|---|
| N-{[(7S)-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl]methyl}-3-(7,8-dimethoxy-2-oxo-1,2,4,5-tetrahydro-3H-3-benzazepin-3-yl)-N-methylpropan-1-aminium |
| Synonym | Source |
|---|---|
| ivabradine cation | ChEBI |