EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36N2O5.HCl |
| Net Charge | 0 |
| Average Mass | 505.055 |
| Monoisotopic Mass | 504.23910 |
| SMILES | COc1cc2c(cc1OC)CC(=O)N(CCCN(C)C[C@H]1Cc3cc(OC)c(OC)cc31)CC2.Cl |
| InChI | InChI=1S/C27H36N2O5.ClH/c1-28(17-21-11-20-14-25(33-4)26(34-5)16-22(20)21)8-6-9-29-10-7-18-12-23(31-2)24(32-3)13-19(18)15-27(29)30;/h12-14,16,21H,6-11,15,17H2,1-5H3;1H/t21-;/m1./s1 |
| InChIKey | HLUKNZUABFFNQS-ZMBIFBSDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ivabradine hydrochloride (CHEBI:85969) has part ivabradine(1+) (CHEBI:85972) |
| ivabradine hydrochloride (CHEBI:85969) has role cardiotonic drug (CHEBI:38147) |
| ivabradine hydrochloride (CHEBI:85969) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 3-{3-[{[(7S)-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl]methyl}(methyl)amino]propyl}-7,8-dimethoxy-1,3,4,5-tetrahydro-2H-3-benzazepin-2-one—hydrogen chloride (1/1) |
| N-{[(7S)-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl]methyl}-3-(7,8-dimethoxy-2-oxo-1,2,4,5-tetrahydro-3H-3-benzazepin-3-yl)-N-methylpropan-1-aminium chloride |
| Synonyms | Source |
|---|---|
| ivabradine | ChEBI |
| ivabradine monohydrochloride | ChEBI |
| Brand Names | Source |
|---|---|
| Corlanor | ChEBI |
| Procoralan | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D08095 | KEGG DRUG |
| Ivabradine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9681567 | Reaxys |
| CAS:148849-67-6 | ChemIDplus |
| CAS:148849-67-6 | KEGG DRUG |
| Citations |
|---|