EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)C(=O)O)[C@@]1(C)CC[C@@]1(O)[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C22H32O4/c1-13(19(24)25)16-6-7-17-18-5-4-14-12-15(23)8-9-21(14,3)22(18,26)11-10-20(16,17)2/h12-13,16-18,26H,4-11H2,1-3H3,(H,24,25)/t13-,16+,17-,18-,20+,21-,22+/m0/s1 |
| InChIKey | JHVIIDLZSOMCBJ-MPITXTFFSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9α-hydroxy-3-oxo-23,24-bisnorchol-4-en-22-oic acid (CHEBI:85910) has parent hydride pregnane (CHEBI:8386) |
| 9α-hydroxy-3-oxo-23,24-bisnorchol-4-en-22-oic acid (CHEBI:85910) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| 9α-hydroxy-3-oxo-23,24-bisnorchol-4-en-22-oic acid (CHEBI:85910) is a 9-hydroxy steroid (CHEBI:63644) |
| 9α-hydroxy-3-oxo-23,24-bisnorchol-4-en-22-oic acid (CHEBI:85910) is a steroid acid (CHEBI:47891) |
| 9α-hydroxy-3-oxo-23,24-bisnorchol-4-en-22-oic acid (CHEBI:85910) is conjugate acid of 9α-hydroxy-3-oxo-23,24-bisnorchol-4-en-22-oate (CHEBI:85550) |
| Incoming Relation(s) |
| 9α-hydroxy-3-oxo-23,24-bisnorchol-4-en-22-oate (CHEBI:85550) is conjugate base of 9α-hydroxy-3-oxo-23,24-bisnorchol-4-en-22-oic acid (CHEBI:85910) |
| Synonym | Source |
|---|---|
| 9α-hydroxy-3-oxo-23,24-dinorchol-4-en-22-oic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-13744 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5623885 | Reaxys |