EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31O4 |
| Net Charge | -1 |
| Average Mass | 359.486 |
| Monoisotopic Mass | 359.22278 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)C(=O)[O-])[C@@]1(C)CC[C@@]1(O)[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C22H32O4/c1-13(19(24)25)16-6-7-17-18-5-4-14-12-15(23)8-9-21(14,3)22(18,26)11-10-20(16,17)2/h12-13,16-18,26H,4-11H2,1-3H3,(H,24,25)/p-1/t13-,16+,17-,18-,20+,21-,22+/m0/s1 |
| InChIKey | JHVIIDLZSOMCBJ-MPITXTFFSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9α-hydroxy-3-oxo-23,24-bisnorchol-4-en-22-oate (CHEBI:85550) is a steroid acid anion (CHEBI:50160) |
| 9α-hydroxy-3-oxo-23,24-bisnorchol-4-en-22-oate (CHEBI:85550) is conjugate base of 9α-hydroxy-3-oxo-23,24-bisnorchol-4-en-22-oic acid (CHEBI:85910) |
| Incoming Relation(s) |
| 9α-hydroxy-3-oxo-23,24-bisnorchol-4-en-22-oic acid (CHEBI:85910) is conjugate acid of 9α-hydroxy-3-oxo-23,24-bisnorchol-4-en-22-oate (CHEBI:85550) |
| UniProt Name | Source |
|---|---|
| 9α-hydroxy-3-oxochol-4-en-22-oate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-13744 | MetaCyc |
| Citations |
|---|