EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO2 |
| Net Charge | 0 |
| Average Mass | 175.187 |
| Monoisotopic Mass | 175.06333 |
| SMILES | Cc1c(C(=O)O)nc2ccccc12 |
| InChI | InChI=1S/C10H9NO2/c1-6-7-4-2-3-5-8(7)11-9(6)10(12)13/h2-5,11H,1H3,(H,12,13) |
| InChIKey | NCXGWFIXUJHVLI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces actuosus (ncbitaxon:1885) | - | PubMed (25196319) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-2-indolic acid (CHEBI:85902) has role bacterial metabolite (CHEBI:76969) |
| 3-methyl-2-indolic acid (CHEBI:85902) is a indolecarboxylic acid (CHEBI:38610) |
| 3-methyl-2-indolic acid (CHEBI:85902) is conjugate acid of 3-methyl-2-indolate (CHEBI:85502) |
| Incoming Relation(s) |
| 3-methyl-2-indolate (CHEBI:85502) is conjugate base of 3-methyl-2-indolic acid (CHEBI:85902) |
| IUPAC Name |
|---|
| 3-methyl-1H-indole-2-carboxylic acid |
| Synonym | Source |
|---|---|
| 3-methylindole-2-carboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5831 | Reaxys |
| Citations |
|---|