EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8NO2 |
| Net Charge | -1 |
| Average Mass | 174.179 |
| Monoisotopic Mass | 174.05605 |
| SMILES | Cc1c(C(=O)[O-])nc2ccccc12 |
| InChI | InChI=1S/C10H9NO2/c1-6-7-4-2-3-5-8(7)11-9(6)10(12)13/h2-5,11H,1H3,(H,12,13)/p-1 |
| InChIKey | NCXGWFIXUJHVLI-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces actuosus (ncbitaxon:1885) | - | PubMed (25196319) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-2-indolate (CHEBI:85502) has role bacterial metabolite (CHEBI:76969) |
| 3-methyl-2-indolate (CHEBI:85502) is a indolecarboxylate (CHEBI:38609) |
| 3-methyl-2-indolate (CHEBI:85502) is conjugate base of 3-methyl-2-indolic acid (CHEBI:85902) |
| Incoming Relation(s) |
| 3-methyl-2-indolic acid (CHEBI:85902) is conjugate acid of 3-methyl-2-indolate (CHEBI:85502) |
| IUPAC Name |
|---|
| 3-methyl-1H-indole-2-carboxylate |
| Synonym | Source |
|---|---|
| 3-methylindole-2-carboxylate | ChEBI |
| Citations |
|---|