EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8Cl2N2 |
| Net Charge | 0 |
| Average Mass | 227.094 |
| Monoisotopic Mass | 226.00645 |
| SMILES | Nc1c(Cl)cccc1-c1cncc1Cl |
| InChI | InChI=1S/C10H8Cl2N2/c11-8-3-1-2-6(10(8)13)7-4-14-5-9(7)12/h1-5,14H,13H2 |
| InChIKey | RWAXAHFFXZKMPA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminopyrrolnitrin (CHEBI:85786) has role androgen antagonist (CHEBI:35497) |
| aminopyrrolnitrin (CHEBI:85786) has role bacterial metabolite (CHEBI:76969) |
| aminopyrrolnitrin (CHEBI:85786) is a indole alkaloid (CHEBI:38958) |
| aminopyrrolnitrin (CHEBI:85786) is a monochlorobenzenes (CHEBI:83403) |
| aminopyrrolnitrin (CHEBI:85786) is a pyrroles (CHEBI:26455) |
| aminopyrrolnitrin (CHEBI:85786) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 2-chloro-6-(4-chloro-1H-pyrrol-3-yl)aniline |
| Synonyms | Source |
|---|---|
| 3-chloro-4-(2-amino-3-chlorophenyl)pyrrole | MetaCyc |
| WB 2838 | ChemIDplus |
| WB-2838 | ChemIDplus |
| UniProt Name | Source |
|---|---|
| aminopyrrolnitrin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12775 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:475715 | Reaxys |
| CAS:16386-65-5 | ChemIDplus |
| Citations |
|---|