EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:85786 - aminopyrrolnitrin
| Formula | C10H8Cl2N2 |
| Net Charge | 0 |
| Average Mass | 227.094 |
| Monoisotopic Mass | 226.00645 |
| SMILES | Nc1c(Cl)cccc1-c1cncc1Cl |
| InChI | InChI=1S/C10H8Cl2N2/c11-8-3-1-2-6(10(8)13)7-4-14-5-9(7)12/h1-5,14H,13H2 |
| InChIKey | RWAXAHFFXZKMPA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminopyrrolnitrin (CHEBI:85786) has role androgen antagonist (CHEBI:35497) |
| aminopyrrolnitrin (CHEBI:85786) has role bacterial metabolite (CHEBI:76969) |
| aminopyrrolnitrin (CHEBI:85786) is a indole alkaloid (CHEBI:38958) |
| aminopyrrolnitrin (CHEBI:85786) is a monochlorobenzenes (CHEBI:83403) |
| aminopyrrolnitrin (CHEBI:85786) is a pyrroles (CHEBI:26455) |
| aminopyrrolnitrin (CHEBI:85786) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 2-chloro-6-(4-chloro-1H-pyrrol-3-yl)aniline |
| Synonyms | Source |
|---|---|
| 3-chloro-4-(2-amino-3-chlorophenyl)pyrrole | MetaCyc |
| WB 2838 | ChemIDplus |
| WB-2838 | ChemIDplus |
| UniProt Name | Source |
|---|---|
| aminopyrrolnitrin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12775 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:475715 | Reaxys |
| CAS:16386-65-5 | ChemIDplus |
| Citations |
|---|