EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O3 |
| Net Charge | 0 |
| Average Mass | 298.467 |
| Monoisotopic Mass | 298.25079 |
| SMILES | CCCCCCCCC1OC1CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O3/c1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20/h16-17H,2-15H2,1H3,(H,19,20) |
| InChIKey | IMYZYCNQZDBZBQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (8520208) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,10-epoxyoctadecanoic acid (CHEBI:85661) has role human metabolite (CHEBI:77746) |
| 9,10-epoxyoctadecanoic acid (CHEBI:85661) is a epoxystearic acid (CHEBI:134617) |
| 9,10-epoxyoctadecanoic acid (CHEBI:85661) is conjugate acid of 9,10-epoxyoctadecanoate (CHEBI:85195) |
| Incoming Relation(s) |
| 1-hexadecanoyl-2-(9,10-epoxyoctadecanoyl)-sn-glycero-3-phosphocholine (CHEBI:131661) has functional parent 9,10-epoxyoctadecanoic acid (CHEBI:85661) |
| 9,10-epoxy-17-hydroxyoctadecanoic acid (CHEBI:138263) has functional parent 9,10-epoxyoctadecanoic acid (CHEBI:85661) |
| 9,10-epoxy-18-hydroxyoctadecanoic acid (CHEBI:133381) has functional parent 9,10-epoxyoctadecanoic acid (CHEBI:85661) |
| cis-9,10-epoxyoctadecanoic acid (CHEBI:82464) is a 9,10-epoxyoctadecanoic acid (CHEBI:85661) |
| 9,10-epoxyoctadecanoate (CHEBI:85195) is conjugate base of 9,10-epoxyoctadecanoic acid (CHEBI:85661) |
| IUPAC Name |
|---|
| 8-(3-octyloxiran-2-yl)octanoic acid |
| Synonym | Source |
|---|---|
| 9,10-epoxystearic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061650 | HMDB |
| LMFA02000326 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:85929 | Reaxys |
| CAS:2443-39-2 | ChemIDplus |
| Citations |
|---|