EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O4 |
| Net Charge | 0 |
| Average Mass | 314.466 |
| Monoisotopic Mass | 314.24571 |
| SMILES | CC(O)CCCCCCC1OC1CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O4/c1-15(19)11-7-5-6-9-13-17-16(22-17)12-8-3-2-4-10-14-18(20)21/h15-17,19H,2-14H2,1H3,(H,20,21) |
| InChIKey | DWJAIICQNIMPBS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,10-epoxy-17-hydroxyoctadecanoic acid (CHEBI:138263) has functional parent 9,10-epoxyoctadecanoic acid (CHEBI:85661) |
| 9,10-epoxy-17-hydroxyoctadecanoic acid (CHEBI:138263) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| 9,10-epoxy-17-hydroxyoctadecanoic acid (CHEBI:138263) is a epoxy fatty acid (CHEBI:61498) |
| 9,10-epoxy-17-hydroxyoctadecanoic acid (CHEBI:138263) is a hydroxyoctadecanoic acid (CHEBI:24747) |
| 9,10-epoxy-17-hydroxyoctadecanoic acid (CHEBI:138263) is conjugate acid of 9,10-epoxy-17-hydroxyoctadecanoate (CHEBI:137465) |
| Incoming Relation(s) |
| 9,10-epoxy-17-hydroxyoctadecanoate (CHEBI:137465) is conjugate base of 9,10-epoxy-17-hydroxyoctadecanoic acid (CHEBI:138263) |
| IUPAC Name |
|---|
| 8-[3-(7-hydroxyoctyl)oxiran-2-yl]octanoic acid |
| Synonyms | Source |
|---|---|
| 17-hydroxy-9,10-epoxyoctadecanoic acid | ChEBI |
| 9,10-epoxy-17-hydroxystearic acid | ChEBI |
| 17-hydroxy-9,10-epoxystearic acid | ChEBI |
| 17,9(10)-HEpSTA | ChEBI |
| Citations |
|---|