EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O7PS |
| Net Charge | -2 |
| Average Mass | 258.188 |
| Monoisotopic Mass | 257.99741 |
| SMILES | CSCC(=O)[C@H](O)[C@H](O)COP(=O)([O-])[O-] |
| WURCS | WURCS=2.0/1,1,0/[hO22h_1*SC_5*OPO/3O/3=O]/1/ |
| InChI | InChI=1S/C6H13O7PS/c1-15-3-5(8)6(9)4(7)2-13-14(10,11)12/h4,6-7,9H,2-3H2,1H3,(H2,10,11,12)/p-2/t4-,6-/m1/s1 |
| InChIKey | JQZPXWYLEQDBGH-INEUFUBQSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhodospirillum rubrum (ncbitaxon:1085) | - | PubMed (18826254) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(methylthio)ribulose 5-phosphate(2−) (CHEBI:85606) has role bacterial metabolite (CHEBI:76969) |
| 1-(methylthio)ribulose 5-phosphate(2−) (CHEBI:85606) is a organophosphate oxoanion (CHEBI:58945) |
| 1-(methylthio)ribulose 5-phosphate(2−) (CHEBI:85606) is a pentose (CHEBI:25901) |
| 1-(methylthio)ribulose 5-phosphate(2−) (CHEBI:85606) is conjugate base of 1-(methylthio)ribulose 5-phosphate (CHEBI:85930) |
| Incoming Relation(s) |
| 1-(methylthio)ribulose 5-phosphate (CHEBI:85930) is conjugate acid of 1-(methylthio)ribulose 5-phosphate(2−) (CHEBI:85606) |
| IUPAC Name |
|---|
| 1-S-methyl-5-O-phosphonato-1-thio-D-ribulose |
| UniProt Name | Source |
|---|---|
| 1-(methylsulfanyl)ribulose 5-phosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-15027 | MetaCyc |
| Citations |
|---|