EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15NO4 |
| Net Charge | 0 |
| Average Mass | 201.222 |
| Monoisotopic Mass | 201.10011 |
| SMILES | N[C@@H](C[C@@H]1CC[C@@H](O)[C@@H]2O[C@H]12)C(=O)O |
| InChI | InChI=1S/C9H15NO4/c10-5(9(12)13)3-4-1-2-6(11)8-7(4)14-8/h4-8,11H,1-3,10H2,(H,12,13)/t4-,5-,6+,7+,8-/m0/s1 |
| InChIKey | YMLXTGCTHGQQKS-TXXZRHAASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus subtilis (ncbitaxon:1423) | - | PubMed (23317005) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-dihydroanticapsin (CHEBI:85360) has role bacterial metabolite (CHEBI:76969) |
| L-dihydroanticapsin (CHEBI:85360) is a L-alanine derivative (CHEBI:83943) |
| L-dihydroanticapsin (CHEBI:85360) is a epoxide (CHEBI:32955) |
| L-dihydroanticapsin (CHEBI:85360) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-dihydroanticapsin (CHEBI:85360) is a oxabicycloalkane (CHEBI:46733) |
| L-dihydroanticapsin (CHEBI:85360) is a secondary alcohol (CHEBI:35681) |
| L-dihydroanticapsin (CHEBI:85360) is tautomer of L-dihydroanticapsin zwitterion (CHEBI:84358) |
| Incoming Relation(s) |
| L-dihydroanticapsin zwitterion (CHEBI:84358) is tautomer of L-dihydroanticapsin (CHEBI:85360) |
| IUPAC Name |
|---|
| 3-[(1R,2S,5R,6S )-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl]-L-alanine |
| Manual Xrefs | Databases |
|---|---|
| CPD-17531 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27406393 | Reaxys |
| Citations |
|---|